|
CAS#: 62338-24-3 Product: 1-(4,5-Diethyl-2-Methyl-1-Cyclopenten-1-Yl)Ethanone No suppilers available for the product. |
| Name | 1-(4,5-Diethyl-2-Methyl-1-Cyclopenten-1-Yl)Ethanone |
|---|---|
| Synonyms | 1-(4,5-Diethyl-2-Methyl-1-Cyclopenten-1-Yl)Ethanone; Ethanone, 1-(4,5-Diethyl-2-Methyl-1-Cyclopenten-1-Yl)-; 1-(4,5-Diethyl-2-Methyl-1-Cyclopenten-1-Yl)Etha* |
| Molecular Structure | ![]() |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 |
| CAS Registry Number | 62338-24-3 |
| SMILES | C(C1C(=C(CC1CC)C)C(C)=O)C |
| InChI | 1S/C12H20O/c1-5-10-7-8(3)12(9(4)13)11(10)6-2/h10-11H,5-7H2,1-4H3 |
| InChIKey | DBGUPVIBNLDIII-UHFFFAOYSA-N |
| Density | 0.882g/cm3 (Cal.) |
|---|---|
| Boiling point | 256.546°C at 760 mmHg (Cal.) |
| Flash point | 100.558°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4,5-Diethyl-2-Methyl-1-Cyclopenten-1-Yl)Ethanone |