|
CAS#: 62338-55-0 Product: (1E,5Z)-9-Isopropylidene-1,5-Cycloundecadiene No suppilers available for the product. |
| Name | (1E,5Z)-9-Isopropylidene-1,5-Cycloundecadiene |
|---|---|
| Synonyms | 1,5-Cycloundecadiene, 9-(1-methylethylidene)-; 9-(1-Methylethylidene)-1,5-cycloundecadiene; 9-(1-Methylethylidene)-1,5-cycloundecadiene # |
| Molecular Structure | ![]() |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.32 |
| CAS Registry Number | 62338-55-0 |
| SMILES | C\1=C\CC/C=C/CC/C(=C(/C)C)CC/1 |
| InChI | 1S/C14H22/c1-13(2)14-11-9-7-5-3-4-6-8-10-12-14/h5-8H,3-4,9-12H2,1-2H3/b7-5-,8-6+ |
| InChIKey | PLJMXUIWEBRXIE-CGXWXWIYSA-N |
| Density | 0.851g/cm3 (Cal.) |
|---|---|
| Boiling point | 279.907°C at 760 mmHg (Cal.) |
| Flash point | 108.963°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1E,5Z)-9-Isopropylidene-1,5-Cycloundecadiene |