|
CAS#: 6236-97-1 Product: 3,4-Dimethyl-9(10H)-acridone No suppilers available for the product. |
| Name | 3,4-Dimethyl-9(10H)-acridone |
|---|---|
| Synonyms | Ck 102; Ck-102; 3,4-Dimethyl-9(10H)-Acridone |
| Molecular Structure | ![]() |
| Molecular Formula | C15H13NO |
| Molecular Weight | 223.27 |
| CAS Registry Number | 6236-97-1 |
| SMILES | C1=C2C(=C(C(=C1)C)C)NC3=C(C2=O)C=CC=C3 |
| InChI | 1S/C15H13NO/c1-9-7-8-12-14(10(9)2)16-13-6-4-3-5-11(13)15(12)17/h3-8H,1-2H3,(H,16,17) |
| InChIKey | ZRMNUBSZWKYSME-UHFFFAOYSA-N |
| Density | 1.168g/cm3 (Cal.) |
|---|---|
| Boiling point | 397.321°C at 760 mmHg (Cal.) |
| Flash point | 162.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4-Dimethyl-9(10H)-acridone |