|
CAS#: 62411-17-0 Product: 16-Phenoxy-17,18,19,20-tetranor-prostaglandin F2-alpha 1,15-lactone No suppilers available for the product. |
| Name | 16-Phenoxy-17,18,19,20-tetranor-prostaglandin F2-alpha 1,15-lactone |
|---|---|
| Synonyms | 16-Phenoxy-17,18,19,20-Tetranor-Pgf2-Alpha 1,15-Lactone; 16-Phenoxy-17,18,19,20-Tetranor-Prostaglandin F2-Alpha 1,15-Lactone; 5H-Cyclopent(E)Oxacyclotridecin-5-One, 3,6,7,8,11,11A,12,13,14,14A-Decahydro-12,14-Dihydroxy-3-(Phenoxymethyl)-, (3R-(1E,3R*,9Z,11Ar*,12S*,14R*,14Ar*)) |
| Molecular Structure | ![]() |
| Molecular Formula | C22H28O5 |
| Molecular Weight | 372.46 |
| CAS Registry Number | 62411-17-0 |
| SMILES | [C@@H]12C(C(O)CC1O)\C=C/[C@@H](OC(=O)CCC\C=C/C2)COC3=CC=CC=C3 |
| InChI | 1S/C22H28O5/c23-20-14-21(24)19-13-12-17(15-26-16-8-4-3-5-9-16)27-22(25)11-7-2-1-6-10-18(19)20/h1,3-6,8-9,12-13,17-21,23-24H,2,7,10-11,14-15H2/b6-1-,13-12-/t17-,18-,19?,20?,21?/m1/s1 |
| InChIKey | ZWESPJLQSOQNEF-BSLUQMTMSA-N |
| Density | 1.155g/cm3 (Cal.) |
|---|---|
| Boiling point | 590.293°C at 760 mmHg (Cal.) |
| Flash point | 205.357°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 16-Phenoxy-17,18,19,20-tetranor-prostaglandin F2-alpha 1,15-lactone |