| Name | N-[(3-Methylphenyl)Methylene]-4-Nitro-Benzenamine |
|---|---|
| Synonyms | (4-Methylbenzylidene)-(4-Nitrophenyl)Amine; N-[(E)-(4-Methylphenyl)Methylidene]-4-Nitroaniline; Benzenamine, N-((3-Methylphenyl)Methylene)-4-Nitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 |
| CAS Registry Number | 62453-03-6 |
| SMILES | C1=CC(=CC=C1N=CC2=CC=C(C=C2)C)[N+](=O)[O-] |
| InChI | 1S/C14H12N2O2/c1-11-2-4-12(5-3-11)10-15-13-6-8-14(9-7-13)16(17)18/h2-10H,1H3 |
| InChIKey | PZHYCUFBBDDVKW-UHFFFAOYSA-N |
| Density | 1.143g/cm3 (Cal.) |
|---|---|
| Boiling point | 407.815°C at 760 mmHg (Cal.) |
| Flash point | 200.439°C (Cal.) |
| (1) | Neuvonen H, Neuvonen K, Fülöp F. Substituent cross-interaction effects on the electronic character of the C=N bridging group in substituted benzylidene anilines - Models for molecular cores of mesogenic compounds. A 13C NMR study and comparison with theoretical results, Journal of Organic Chemistry, 2006, 71(8), 3141-3148 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-[(3-Methylphenyl)Methylene]-4-Nitro-Benzenamine |