|
CAS#: 62484-89-3 Product: (2-Chloroallyl) propyl N,N-dimethylphosphoramidate No suppilers available for the product. |
| Name | (2-Chloroallyl) propyl N,N-dimethylphosphoramidate |
|---|---|
| Synonyms | N-(2-Chloroprop-2-Enoxy-Propoxy-Phosphoryl)-N-Ethyl-Ethanamine; (2-Chloroprop-2-Enoxy-Propoxy-Phosphoryl)-Diethyl-Amine; Brn 2371143 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H21ClNO3P |
| Molecular Weight | 269.71 |
| CAS Registry Number | 62484-89-3 |
| SMILES | C(N([P](=O)(OCCC)OCC(=C)Cl)CC)C |
| InChI | 1S/C10H21ClNO3P/c1-5-8-14-16(13,12(6-2)7-3)15-9-10(4)11/h4-9H2,1-3H3 |
| InChIKey | IKNBEHDALFQGMA-UHFFFAOYSA-N |
| Density | 1.105g/cm3 (Cal.) |
|---|---|
| Boiling point | 300.371°C at 760 mmHg (Cal.) |
| Flash point | 135.46°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2-Chloroallyl) propyl N,N-dimethylphosphoramidate |