|
CAS#: 625-20-7 Product: Lombricine No suppilers available for the product. |
| Name | Lombricine |
|---|---|
| Synonyms | (2S)-2-Amino-3-(2-Guanidinoethoxy-Hydroxy-Phosphoryl)Oxy-Propanoic Acid; (2S)-2-Amino-3-(2-Guanidinoethoxy-Hydroxyphosphoryl)Oxypropanoic Acid; (2S)-2-Amino-3-(2-Guanidinoethoxy-Hydroxy-Phosphoryl)Oxy-Propionic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C6H15N4O6P |
| Molecular Weight | 270.18 |
| CAS Registry Number | 625-20-7 (18416-85-8) |
| SMILES | [C@H](N)(CO[P](OCCN=C(N)N)(O)=O)C(O)=O |
| InChI | 1S/C6H15N4O6P/c7-4(5(11)12)3-16-17(13,14)15-2-1-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H,13,14)(H4,8,9,10)/t4-/m0/s1 |
| InChIKey | GSDBGCKBBJVPNC-BYPYZUCNSA-N |
| Density | 1.839g/cm3 (Cal.) |
|---|---|
| Boiling point | 540.924°C at 760 mmHg (Cal.) |
| Flash point | 280.941°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Lombricine |