|
CAS#: 625113-61-3 Product: 2-[3-Chloro-4-(methylsulfonyl)phenyl]-3-(2-oxocyclopentyl)propanoic acid No suppilers available for the product. |
| Name | 2-[3-Chloro-4-(methylsulfonyl)phenyl]-3-(2-oxocyclopentyl)propanoic acid |
|---|---|
| Synonyms | (R)-2-(3- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H17ClO5S |
| Molecular Weight | 344.81 |
| CAS Registry Number | 625113-61-3 |
| SMILES | O=C2CCCC2CC(C(O)=O)c1ccc(c(Cl)c1)S(C)(=O)=O |
| InChI | 1S/C15H17ClO5S/c1-22(20,21)14-6-5-9(8-12(14)16)11(15(18)19)7-10-3-2-4-13(10)17/h5-6,8,10-11H,2-4,7H2,1H3,(H,18,19) |
| InChIKey | PGXGGUSHFUXQHF-UHFFFAOYSA-N |
| Density | 1.384g/cm3 (Cal.) |
|---|---|
| Boiling point | 566.789°C at 760 mmHg (Cal.) |
| Flash point | 296.584°C (Cal.) |
| Refractive index | 1.57 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[3-Chloro-4-(methylsulfonyl)phenyl]-3-(2-oxocyclopentyl)propanoic acid |