Online Database of Chemicals from Around the World
|
CAS#: 6257-39-2 Product: 3,4',5-Tris(1,1-Dimethylethyl)[1,1'-Biphenyl]-4-Ol No suppilers available for the product. |
| Name | 3,4',5-Tris(1,1-Dimethylethyl)[1,1'-Biphenyl]-4-Ol |
|---|---|
| Synonyms | (1,1'-Biphenyl)-4-Ol, 3,4',5-Tris(1,1-Dimethylethyl)-; 3,4',5-Tris(1,1-Dimethylethyl)(1,1'-Biphenyl)-4-Ol; 4-Biphenylol, 3,4',5-Tri-Tert-Butyl- |
| Molecular Structure | ![CAS#: 6257-39-2, 3,4',5-Tris(1,1-Dimethylethyl)[1,1'-Biphenyl]-4-Ol](/moreStructures/6257-39-2.gif) |
| Molecular Formula | C24H34O |
| Molecular Weight | 338.53 |
| CAS Registry Number | 6257-39-2 |
| EINECS | 228-387-3 |
| SMILES | C1=C(C=CC(=C1)C2=CC(=C(C(=C2)C(C)(C)C)O)C(C)(C)C)C(C)(C)C |
| InChI | 1S/C24H34O/c1-22(2,3)18-12-10-16(11-13-18)17-14-19(23(4,5)6)21(25)20(15-17)24(7,8)9/h10-15,25H,1-9H3 |
| InChIKey | USTAEAIVHPZIQS-UHFFFAOYSA-N |
| Density | 0.958g/cm3 (Cal.) |
|---|---|
| Boiling point | 405.809°C at 760 mmHg (Cal.) |
| Flash point | 185.522°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4',5-Tris(1,1-Dimethylethyl)[1,1'-Biphenyl]-4-Ol |