|
CAS#: 625839-53-4 Product: 2-Methyl-5-(2-pyridinylamino)-1,4-benzoquinone No suppilers available for the product. |
| Name | 2-Methyl-5-(2-pyridinylamino)-1,4-benzoquinone |
|---|---|
| Synonyms | 2,5-CYCLO |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 |
| CAS Registry Number | 625839-53-4 |
| SMILES | O=C\1\C=C(/C(=O)/C=C/1C)Nc2ncccc2 |
| InChI | 1S/C12H10N2O2/c1-8-6-11(16)9(7-10(8)15)14-12-4-2-3-5-13-12/h2-7H,1H3,(H,13,14) |
| InChIKey | ALKZMYALXIBOPQ-UHFFFAOYSA-N |
| Density | 1.337g/cm3 (Cal.) |
|---|---|
| Boiling point | 376.288°C at 760 mmHg (Cal.) |
| Flash point | 181.373°C (Cal.) |
| Refractive index | 1.66 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-5-(2-pyridinylamino)-1,4-benzoquinone |