|
CAS#: 62635-54-5 Product: N-(2-Chlorophenyl)-3,3-Dimethyl-Butanethioamide No suppilers available for the product. |
| Name | N-(2-Chlorophenyl)-3,3-Dimethyl-Butanethioamide |
|---|---|
| Synonyms | N-(2-Chlorophenyl)-3,3-Dimethyl-Butanethioamide; N-(2-Chlorophenyl)-3,3-Dimethyl-Thiobutyramide; Butanethioamide, N-(2-Chlorophenyl)-3,3-Dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16ClNS |
| Molecular Weight | 241.78 |
| CAS Registry Number | 62635-54-5 |
| SMILES | C1=CC=CC(=C1Cl)NC(=S)CC(C)(C)C |
| InChI | 1S/C12H16ClNS/c1-12(2,3)8-11(15)14-10-7-5-4-6-9(10)13/h4-7H,8H2,1-3H3,(H,14,15) |
| InChIKey | FNCJITWNQRNHPC-UHFFFAOYSA-N |
| Density | 1.16g/cm3 (Cal.) |
|---|---|
| Boiling point | 309.041°C at 760 mmHg (Cal.) |
| Flash point | 140.703°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2-Chlorophenyl)-3,3-Dimethyl-Butanethioamide |