|
CAS#: 62654-10-8 Product: 1-(4-{2-[4-(Dimethylamino)Phenyl]Vinyl}Phenyl)-1H-Pyrrole-2,5-Dione No suppilers available for the product. |
| Name | 1-(4-{2-[4-(Dimethylamino)Phenyl]Vinyl}Phenyl)-1H-Pyrrole-2,5-Dione |
|---|---|
| Synonyms | 1H-Pyrrol |
| Molecular Structure | ![]() |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.37 |
| CAS Registry Number | 62654-10-8 |
| SMILES | O=C3\C=C/C(=O)N3c2ccc(C=Cc1ccc(N(C)C)cc1)cc2 |
| InChI | 1S/C20H18N2O2/c1-21(2)17-9-5-15(6-10-17)3-4-16-7-11-18(12-8-16)22-19(23)13-14-20(22)24/h3-14H,1-2H3 |
| InChIKey | LMRAUYMGCPFJAH-UHFFFAOYSA-N |
| Density | 1.266g/cm3 (Cal.) |
|---|---|
| Boiling point | 520.435°C at 760 mmHg (Cal.) |
| Flash point | 237.054°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-{2-[4-(Dimethylamino)Phenyl]Vinyl}Phenyl)-1H-Pyrrole-2,5-Dione |