|
CAS#: 6266-81-5 Product: Piperazinium Thymol-6-Sulphonate No suppilers available for the product. |
| Name | Piperazinium Thymol-6-Sulphonate |
|---|---|
| Synonyms | 4-Hydroxy-5-Isopropyl-2-Methyl-Benzenesulfonic Acid; Piperazine; 4-Hydroxy-5-Isopropyl-2-Methylbenzenesulfonic Acid; Piperazine; 4-Hydroxy-2-Methyl-5-Propan-2-Yl-Benzenesulfonic Acid; Piperazine |
| Molecular Structure | ![]() |
| Molecular Formula | C14H24N2O4S |
| Molecular Weight | 316.41 |
| CAS Registry Number | 6266-81-5 |
| EINECS | 228-435-3 |
| SMILES | C1=C([S](O)(=O)=O)C(=CC(=C1C(C)C)O)C.C2NCCNC2 |
| InChI | 1S/C10H14O4S.C4H10N2/c1-6(2)8-5-10(15(12,13)14)7(3)4-9(8)11;1-2-6-4-3-5-1/h4-6,11H,1-3H3,(H,12,13,14);5-6H,1-4H2 |
| InChIKey | VJOODGFNRKLOGH-UHFFFAOYSA-N |
| Boiling point | 532.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 276.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Piperazinium Thymol-6-Sulphonate |