|
CAS#: 6268-86-6 Product: 3,4-Dihydro-6,7-Dimethoxy-1-Methylisoquinoline Hydrochloride No suppilers available for the product. |
| Name | 3,4-Dihydro-6,7-Dimethoxy-1-Methylisoquinoline Hydrochloride |
|---|---|
| Synonyms | 3,4-Dihydro-6,7-Dimethoxy-1-Methylisoquinoline Hydrochloride; Isoquinoline, 3,4-Dihydro-6,7-Dimethoxy-1-Methyl-, Hydrochloride; Nsc 34653 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16ClNO2 |
| Molecular Weight | 241.72 |
| CAS Registry Number | 6268-86-6 |
| SMILES | C1=C(C(=CC2=C1CC[NH+]=C2C)OC)OC.[Cl-] |
| InChI | 1S/C12H15NO2.ClH/c1-8-10-7-12(15-3)11(14-2)6-9(10)4-5-13-8;/h6-7H,4-5H2,1-3H3;1H |
| InChIKey | IIOABNZXNMDTCF-UHFFFAOYSA-N |
| Boiling point | 312.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 117°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4-Dihydro-6,7-Dimethoxy-1-Methylisoquinoline Hydrochloride |