|
CAS#: 62698-52-6 Product: Magnesium phenyl phosphate No suppilers available for the product. |
| Name | Magnesium phenyl phosphate |
|---|---|
| Synonyms | Phosphoric Acid, Monophenyl Ester, Magnesium Salt (1:1) |
| Molecular Structure | ![]() |
| Molecular Formula | C6H5MgO4P |
| Molecular Weight | 196.38 |
| CAS Registry Number | 62698-52-6 |
| SMILES | C1=C(O[P]([O-])([O-])=O)C=CC=C1.[Mg++] |
| InChI | 1S/C6H7O4P.Mg/c7-11(8,9)10-6-4-2-1-3-5-6;/h1-5H,(H2,7,8,9);/q;+2/p-2 |
| InChIKey | JGIZKLDQCIOYLH-UHFFFAOYSA-L |
| Boiling point | 346.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 163.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Magnesium phenyl phosphate |