|
CAS#: 62725-49-9 Product: 6,6,8,8-Tetraphenyl-1,3,5,7,2,4,6,8-tetroxatetrasilocane-2,2,4,4-tetrol No suppilers available for the product. |
| Name | 6,6,8,8-Tetraphenyl-1,3,5,7,2,4,6,8-tetroxatetrasilocane-2,2,4,4-tetrol |
|---|---|
| Synonyms | Tetraphenyltetrahydroxycyclotetrasiloxane |
| Molecular Structure | ![]() |
| Molecular Formula | C24H24O8Si4 |
| Molecular Weight | 552.78 |
| CAS Registry Number | 62725-49-9 |
| SMILES | c1ccc(cc1)[Si]2(O[Si](O[Si](O[Si](O2)(O)O)(O)O)(c3ccccc3)c4ccccc4)c5ccccc5 |
| InChI | 1S/C24H24O8Si4/c25-35(26)30-33(21-13-5-1-6-14-21,22-15-7-2-8-16-22)29-34(31-36(27,28)32-35,23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20,25-28H |
| InChIKey | HSUXWOJYMFIRNM-UHFFFAOYSA-N |
| Density | 1.363g/cm3 (Cal.) |
|---|---|
| Boiling point | 575.892°C at 760 mmHg (Cal.) |
| Flash point | 302.089°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,6,8,8-Tetraphenyl-1,3,5,7,2,4,6,8-tetroxatetrasilocane-2,2,4,4-tetrol |