| 
CAS#: 62746-84-3 Product: Ribose-5-Triphosphate No suppilers available for the product.  | 
| Name | Ribose-5-Triphosphate | 
|---|---|
| Synonyms | (Hydroxy-Phosphonooxy-Phosphoryl) [(2R,3R,4R)-2,3,4-Trihydroxy-5-Oxo-Pentyl] Hydrogen Phosphate; (Hydroxy-Phosphonooxy-Phosphoryl) [(2R,3R,4R)-2,3,4-Trihydroxy-5-Keto-Pentyl] Hydrogen Phosphate; Ribose-5-Triphosphate | 
| Molecular Structure | ![]()  | 
| Molecular Formula | C5H13O14P3 | 
| Molecular Weight | 390.07 | 
| CAS Registry Number | 62746-84-3 | 
| SMILES | [C@@H](C=O)(O)[C@H](O)[C@H](O)CO[P](O[P](O[P](=O)(O)O)(=O)O)(=O)O | 
| InChI | 1S/C5H13O14P3/c6-1-3(7)5(9)4(8)2-17-21(13,14)19-22(15,16)18-20(10,11)12/h1,3-5,7-9H,2H2,(H,13,14)(H,15,16)(H2,10,11,12)/t3-,4+,5-/m0/s1 | 
| InChIKey | YBGQTWSTXIMEHK-LMVFSUKVSA-N | 
| Density | 2.125g/cm3 (Cal.) | 
|---|---|
| Boiling point | 752.292°C at 760 mmHg (Cal.) | 
| Flash point | 408.771°C (Cal.) | 
| Market Analysis Reports | 
| List of Reports Available for Ribose-5-Triphosphate |