|
CAS#: 6278-69-9 Product: 2-(Dichloromethyl)-Benzothiazole No suppilers available for the product. |
| Name | 2-(Dichloromethyl)-Benzothiazole |
|---|---|
| Synonyms | Nsc34440 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H5Cl2NS |
| Molecular Weight | 218.10 |
| CAS Registry Number | 6278-69-9 |
| SMILES | C1=CC=CC2=C1N=C(C(Cl)Cl)S2 |
| InChI | 1S/C8H5Cl2NS/c9-7(10)8-11-5-3-1-2-4-6(5)12-8/h1-4,7H |
| InChIKey | IEHOAJPYPWLJIC-UHFFFAOYSA-N |
| Density | 1.493g/cm3 (Cal.) |
|---|---|
| Boiling point | 275.6°C at 760 mmHg (Cal.) |
| Flash point | 120.479°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Dichloromethyl)-Benzothiazole |