|
CAS#: 62819-95-8 Product: beta-Methoxy-2-Nitrophenetole No suppilers available for the product. |
| Name | beta-Methoxy-2-Nitrophenetole |
|---|---|
| Synonyms | 1-(2-Methoxyethoxy)-2-Nitro-Benzene; Beta-Methoxy-2-Nitrophenetole |
| Molecular Structure | ![]() |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 |
| CAS Registry Number | 62819-95-8 |
| EINECS | 263-737-9 |
| SMILES | C1=CC=CC(=C1OCCOC)[N+]([O-])=O |
| InChI | 1S/C9H11NO4/c1-13-6-7-14-9-5-3-2-4-8(9)10(11)12/h2-5H,6-7H2,1H3 |
| InChIKey | DJTJGNJDSIOAOS-UHFFFAOYSA-N |
| Density | 1.198g/cm3 (Cal.) |
|---|---|
| Boiling point | 316.546°C at 760 mmHg (Cal.) |
| Flash point | 146.468°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for beta-Methoxy-2-Nitrophenetole |