|
CAS#: 628302-58-9 Product: 7-Ethyl-4-methoxy-2H-furo[3,4-b]pyran-2,5(7H)-dione No suppilers available for the product. |
| Name | 7-Ethyl-4-methoxy-2H-furo[3,4-b]pyran-2,5(7H)-dione |
|---|---|
| Synonyms | 2H-furo[3,4-b]pyran-2,5(7H)-dione, 7-ethyl-4-methoxy-; 2H-FURO[3,4-B]PYRAN-2,5(7H)-DIONE, 7-ETHYL-4-METHOXY-, (7S)- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10O5 |
| Molecular Weight | 210.18 |
| CAS Registry Number | 628302-58-9 |
| SMILES | CCC1C2=C(C(=CC(=O)O2)OC)C(=O)O1 |
| InChI | 1S/C10H10O5/c1-3-5-9-8(10(12)14-5)6(13-2)4-7(11)15-9/h4-5H,3H2,1-2H3 |
| InChIKey | LAVJUISMIZTLGI-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 414.3±45.0°C at 760 mmHg (Cal.) |
| Flash point | 189.5±28.8°C (Cal.) |
| Refractive index | 1.537 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Ethyl-4-methoxy-2H-furo[3,4-b]pyran-2,5(7H)-dione |