|
CAS#: 62850-21-9 Product: 3,4-Bis(1,1-Dimethylethyl)-2,2,5,5-Tetramethylhexane No suppilers available for the product. |
| Name | 3,4-Bis(1,1-Dimethylethyl)-2,2,5,5-Tetramethylhexane |
|---|---|
| Synonyms | 3,4-Ditert-Butyl-2,2,5,5-Tetramethylhexane; Hexane, 3,4-Bis(1,1-Dimethylethyl)-2,2,5,5-Tetramethyl-; 1,1,2,2-Tetra-T-Butylethane |
| Molecular Structure | ![]() |
| Molecular Formula | C18H38 |
| Molecular Weight | 254.50 |
| CAS Registry Number | 62850-21-9 |
| SMILES | CC(C(C(C(C)(C)C)C(C)(C)C)C(C)(C)C)(C)C |
| InChI | 1S/C18H38/c1-15(2,3)13(16(4,5)6)14(17(7,8)9)18(10,11)12/h13-14H,1-12H3 |
| InChIKey | RMASWOHNLWIUPT-UHFFFAOYSA-N |
| Density | 0.779g/cm3 (Cal.) |
|---|---|
| Boiling point | 289.765°C at 760 mmHg (Cal.) |
| Flash point | 130.255°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4-Bis(1,1-Dimethylethyl)-2,2,5,5-Tetramethylhexane |