|
CAS#: 6287-71-4 Product: 2-Methylamino-1,2-Diphenyl-Ethanol No suppilers available for the product. |
| Name | 2-Methylamino-1,2-Diphenyl-Ethanol |
|---|---|
| Synonyms | 2-Methylamino-1,2-Diphenyl-Ethanol Hydrochloride; Benzyl Alcohol, Alpha-(Alpha-Methylaminobenzyl)-, Hydrochloride; Do9430000 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H18ClNO |
| Molecular Weight | 263.77 |
| CAS Registry Number | 6287-71-4 |
| SMILES | [H+].C2=C(C(NC)C(O)C1=CC=CC=C1)C=CC=C2.[Cl-] |
| InChI | 1S/C15H17NO.ClH/c1-16-14(12-8-4-2-5-9-12)15(17)13-10-6-3-7-11-13;/h2-11,14-17H,1H3;1H |
| InChIKey | SDMACCGLNQNUOE-UHFFFAOYSA-N |
| Boiling point | 355.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 113.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methylamino-1,2-Diphenyl-Ethanol |