|
CAS#: 6295-10-9 Product: Bis[2-(Dichloroarsino)Ethyl] Sulfone No suppilers available for the product. |
| Name | Bis[2-(Dichloroarsino)Ethyl] Sulfone |
|---|---|
| Synonyms | (Sulfonyldiethylene)Bisdichloroarsine; Arsine, (Sulfonyldiethylene)Bis[Dichloro-; Nsc11803 |
| Molecular Structure | ![]() |
| Molecular Formula | C4H8As2Cl4O2S |
| Molecular Weight | 411.82 |
| CAS Registry Number | 6295-10-9 |
| SMILES | C([S](CC[As](Cl)Cl)(=O)=O)C[As](Cl)Cl |
| InChI | 1S/C4H8As2Cl4O2S/c7-5(8)1-3-13(11,12)4-2-6(9)10/h1-4H2 |
| InChIKey | OZVRCSKRYJPQCH-UHFFFAOYSA-N |
| Boiling point | 529.878°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 274.26°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis[2-(Dichloroarsino)Ethyl] Sulfone |