Online Database of Chemicals from Around the World
|
CAS#: 6298-44-8 Product: N-Benzyl-3-Chloro-7,9,10-Triazabicyclo[4.4.0]Deca-2,4,7,9,11-Pentaen-8 -Amine No suppilers available for the product. |
| Name | N-Benzyl-3-Chloro-7,9,10-Triazabicyclo[4.4.0]Deca-2,4,7,9,11-Pentaen-8 -Amine |
|---|---|
| Synonyms | Benzyl-(7-Chloro-1,2,4-Benzotriazin-3-Yl)Amine; Nsc41821; 3-Benzylamino-7-Chloro-1,2,4-Benzotriazine |
| Molecular Structure | ![CAS#: 6298-44-8, N-Benzyl-3-Chloro-7,9,10-Triazabicyclo[4.4.0]Deca-2,4,7,9,11-Pentaen-8 -Amine](/moreStructures/6298-44-8.gif) |
| Molecular Formula | C14H11ClN4 |
| Molecular Weight | 270.72 |
| CAS Registry Number | 6298-44-8 |
| SMILES | C1=C(C=CC2=C1N=NC(=N2)NCC3=CC=CC=C3)Cl |
| InChI | 1S/C14H11ClN4/c15-11-6-7-12-13(8-11)18-19-14(17-12)16-9-10-4-2-1-3-5-10/h1-8H,9H2,(H,16,17,19) |
| InChIKey | AIZHAMIKDJNSCU-UHFFFAOYSA-N |
| Density | 1.386g/cm3 (Cal.) |
|---|---|
| Boiling point | 473.789°C at 760 mmHg (Cal.) |
| Flash point | 240.339°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Benzyl-3-Chloro-7,9,10-Triazabicyclo[4.4.0]Deca-2,4,7,9,11-Pentaen-8 -Amine |