|
CAS#: 6299-40-7 Product: 2-Methylaminoethyl Benzoate, 4-Methylbenzenesulfonic Acid No suppilers available for the product. |
| Name | 2-Methylaminoethyl Benzoate, 4-Methylbenzenesulfonic Acid |
|---|---|
| Synonyms | Benzoic Acid 2-Methylaminoethyl Ester; 4-Methylbenzenesulfonic Acid; Nsc44658 |
| Molecular Structure | ![]() |
| Molecular Formula | C17H21NO5S |
| Molecular Weight | 351.42 |
| CAS Registry Number | 6299-40-7 |
| SMILES | C1=CC(=CC=C1[S](O)(=O)=O)C.C2=C(C=CC=C2)C(OCCNC)=O |
| InChI | 1S/C10H13NO2.C7H8O3S/c1-11-7-8-13-10(12)9-5-3-2-4-6-9;1-6-2-4-7(5-3-6)11(8,9)10/h2-6,11H,7-8H2,1H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | XUMPOHMDFHVJRM-UHFFFAOYSA-N |
| Boiling point | 276.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 121°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methylaminoethyl Benzoate, 4-Methylbenzenesulfonic Acid |