|
CAS#: 630-86-4 Product: Benzylmorphine No suppilers available for the product. |
| Name | Benzylmorphine |
|---|---|
| Synonyms | Morphinan-6-Alpha-Ol, 3-(Benzyloxy)-7,8-Didehydro-4,5-Alpha-Epoxy-17-Methyl-, Hydrochloride; Peronin; Peronine |
| Molecular Structure | ![]() |
| Molecular Formula | C24H26ClNO3 |
| Molecular Weight | 411.93 |
| CAS Registry Number | 630-86-4 |
| SMILES | [C@]125C6[C@H](N(CC1)C)CC4=C2C(=C(OCC3=CC=CC=C3)C=C4)OC5[C@@H](O)C=C6.[H+].[Cl-] |
| InChI | 1S/C24H25NO3.ClH/c1-25-12-11-24-17-8-9-19(26)23(24)28-22-20(27-14-15-5-3-2-4-6-15)10-7-16(21(22)24)13-18(17)25;/h2-10,17-19,23,26H,11-14H2,1H3;1H/t17?,18-,19+,23?,24+;/m1./s1 |
| InChIKey | DXGNJCKAQUHNAJ-YAWPYZGLSA-N |
| Boiling point | 552.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 287.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzylmorphine |