|
CAS#: 63004-24-0 Product: N-(2-Bromoethyl)-2-Nitrobenzamide No suppilers available for the product. |
| Name | N-(2-Bromoethyl)-2-Nitrobenzamide |
|---|---|
| Synonyms | N-(2-Bromoethyl)-2-Nitro-Benzamide |
| Molecular Structure | ![]() |
| Molecular Formula | C9H9BrN2O3 |
| Molecular Weight | 273.09 |
| CAS Registry Number | 63004-24-0 |
| EINECS | 263-786-6 |
| SMILES | C1=CC=CC(=C1C(=O)NCCBr)[N+]([O-])=O |
| InChI | 1S/C9H9BrN2O3/c10-5-6-11-9(13)7-3-1-2-4-8(7)12(14)15/h1-4H,5-6H2,(H,11,13) |
| InChIKey | VNYZLKGRVHTMIQ-UHFFFAOYSA-N |
| Density | 1.594g/cm3 (Cal.) |
|---|---|
| Boiling point | 425.474°C at 760 mmHg (Cal.) |
| Flash point | 211.12°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2-Bromoethyl)-2-Nitrobenzamide |