|
CAS#: 63019-51-2 Product: 6-(1-Aziridinyl)-4-Chloro-2-Phenylpyrimidine No suppilers available for the product. |
| Name | 6-(1-Aziridinyl)-4-Chloro-2-Phenylpyrimidine |
|---|---|
| Synonyms | 4-(Aziridin-1-Yl)-6-Chloro-2-Phenyl-Pyrimidine; 4-(1-Aziridinyl)-6-Chloro-2-Phenylpyrimidine; 4-Chloro-6-Ethylenimino-2-Phenyl-Pyrimidine |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10ClN3 |
| Molecular Weight | 231.68 |
| CAS Registry Number | 63019-51-2 |
| SMILES | C2=C(N1CC1)N=C(N=C2Cl)C3=CC=CC=C3 |
| InChI | 1S/C12H10ClN3/c13-10-8-11(16-6-7-16)15-12(14-10)9-4-2-1-3-5-9/h1-5,8H,6-7H2 |
| InChIKey | HANLIIBFXPRKMI-UHFFFAOYSA-N |
| Density | 1.346g/cm3 (Cal.) |
|---|---|
| Boiling point | 299.176°C at 760 mmHg (Cal.) |
| Flash point | 134.737°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-(1-Aziridinyl)-4-Chloro-2-Phenylpyrimidine |