|
CAS#: 63020-61-1 Product: 8-Methoxy-7-Methylbenz[a]Anthracene No suppilers available for the product. |
| Name | 8-Methoxy-7-Methylbenz[a]Anthracene |
|---|---|
| Synonyms | 8-Methoxy-7-Methyl-Benzo[B]Phenanthrene; 3-06-00-03736 (Beilstein Handbook Reference); 5-Methoxy-10-Methyl-1,2-Benzanthracene |
| Molecular Structure | ![]() |
| Molecular Formula | C20H16O |
| Molecular Weight | 272.35 |
| CAS Registry Number | 63020-61-1 |
| SMILES | C1=C3C(=C(C2=C1C=CC=C2OC)C)C=CC4=C3C=CC=C4 |
| InChI | 1S/C20H16O/c1-13-16-11-10-14-6-3-4-8-17(14)18(16)12-15-7-5-9-19(21-2)20(13)15/h3-12H,1-2H3 |
| InChIKey | KLTNCIFNUYQMON-UHFFFAOYSA-N |
| Density | 1.174g/cm3 (Cal.) |
|---|---|
| Boiling point | 481.474°C at 760 mmHg (Cal.) |
| Flash point | 198.665°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Methoxy-7-Methylbenz[a]Anthracene |