|
CAS#: 63025-48-9 Product: 2-Methyl-2-(4-Methylpent-3-Enyl)-2H-Chromen-6-Ol No suppilers available for the product. |
| Name | 2-Methyl-2-(4-Methylpent-3-Enyl)-2H-Chromen-6-Ol |
|---|---|
| Synonyms | 2-Methyl-2-(4-Methylpent-3-Enyl)-6-Chromenol; Mmpco; 2-Methyl-2-(4-Methylpent-3-Enyl)-2H-Chromen-6-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 |
| CAS Registry Number | 63025-48-9 |
| SMILES | C1=C(C=CC2=C1C=CC(O2)(CCC=C(C)C)C)O |
| InChI | 1S/C16H20O2/c1-12(2)5-4-9-16(3)10-8-13-11-14(17)6-7-15(13)18-16/h5-8,10-11,17H,4,9H2,1-3H3 |
| InChIKey | CEZCHPFUKBTQGN-UHFFFAOYSA-N |
| Density | 1.042g/cm3 (Cal.) |
|---|---|
| Boiling point | 377.008°C at 760 mmHg (Cal.) |
| Flash point | 161.758°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-(4-Methylpent-3-Enyl)-2H-Chromen-6-Ol |