|
CAS#: 6303-05-5 Product: 3,7-Diacetylnon-3-Ene-2,8-Dione No suppilers available for the product. |
| Name | 3,7-Diacetylnon-3-Ene-2,8-Dione |
|---|---|
| Synonyms | 3,7-Diethanoylnon-3-Ene-2,8-Dione; Nsc42207 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 |
| CAS Registry Number | 6303-05-5 |
| SMILES | C(C(C(C)=O)C(C)=O)CC=C(C(C)=O)C(C)=O |
| InChI | 1S/C13H18O4/c1-8(14)12(9(2)15)6-5-7-13(10(3)16)11(4)17/h6,13H,5,7H2,1-4H3 |
| InChIKey | KVOLXMWIJWDXTN-UHFFFAOYSA-N |
| Density | 1.057g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.666°C at 760 mmHg (Cal.) |
| Flash point | 184.421°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,7-Diacetylnon-3-Ene-2,8-Dione |