Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 2,3,4,9-Tetrahydro-9-Methyl-1H-Carbazole |
|---|---|
| Synonyms | Nsc42986; Nsc10148; N-Methyl-Tetrahydrocarbazole |
| Molecular Structure |  |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 |
| CAS Registry Number | 6303-88-4 |
| SMILES | C3=C2C1=C(CCCC1)[N](C2=CC=C3)C |
| InChI | 1S/C13H15N/c1-14-12-8-4-2-6-10(12)11-7-3-5-9-13(11)14/h2,4,6,8H,3,5,7,9H2,1H3 |
| InChIKey | LXRZSWPAXJBXQM-UHFFFAOYSA-N |
| Density | 1.115g/cm3 (Cal.) |
|---|---|
| Melting point | 52°C (Expl.) |
| Boiling point | 339.698°C at 760 mmHg (Cal.) |
| Flash point | 159.244°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,4,9-Tetrahydro-9-Methyl-1H-Carbazole |