|
CAS#: 6304-46-7 Product: 5-Nitro-1-Naphthol No suppilers available for the product. |
| Name | 5-Nitro-1-Naphthol |
|---|---|
| Synonyms | 5-Nitro-1-Naphthalenol; 5-Nitro-1-Naphthol; 1-Naphthalenol, 5-Nitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H7NO3 |
| Molecular Weight | 189.17 |
| CAS Registry Number | 6304-46-7 |
| SMILES | C2=CC=C1C(=CC=CC1=C2[N+]([O-])=O)O |
| InChI | 1S/C10H7NO3/c12-10-6-2-3-7-8(10)4-1-5-9(7)11(13)14/h1-6,12H |
| InChIKey | RIXNIZKEKXPLIT-UHFFFAOYSA-N |
| Density | 1.414g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.892°C at 760 mmHg (Cal.) |
| Flash point | 171.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Nitro-1-Naphthol |