|
CAS#: 63040-54-0 Product: Dibenzo[b,def]Chrysene-7-Carbaldehyde No suppilers available for the product. |
| Name | Dibenzo[b,def]Chrysene-7-Carbaldehyde |
|---|---|
| Synonyms | 5-Formyl-3,4:8,9-Dibenzopyrene; Brn 2594145; Dibenzo(B,Def)Chrysene-7-Carboxaldehyde |
| Molecular Structure | ![]() |
| Molecular Formula | C25H14O |
| Molecular Weight | 330.39 |
| CAS Registry Number | 63040-54-0 |
| SMILES | C1=CC4=C3C2=C1C6=C(C(=C2C=CC3=C5C(=C4)C=CC=C5)C=O)C=CC=C6 |
| InChI | 1S/C25H14O/c26-14-23-19-8-4-3-7-18(19)21-10-9-16-13-15-5-1-2-6-17(15)20-11-12-22(23)25(21)24(16)20/h1-14H |
| InChIKey | SMNAQDLLFBJHTK-UHFFFAOYSA-N |
| Density | 1.366g/cm3 (Cal.) |
|---|---|
| Boiling point | 606.896°C at 760 mmHg (Cal.) |
| Flash point | 419.945°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dibenzo[b,def]Chrysene-7-Carbaldehyde |