|
CAS#: 6305-90-4 Product: 1,8-Dichloro-4,5-Dinitroanthraquinone No suppilers available for the product. |
| Name | 1,8-Dichloro-4,5-Dinitroanthraquinone |
|---|---|
| Synonyms | 1,8-Dichloro-4,5-Dinitro-Anthracene-9,10-Dione; 1,8-Dichloro-4,5-Dinitro-9,10-Anthraquinone; 1,8-Dichloro-4,5-Dinitroanthraquinone |
| Molecular Structure | ![]() |
| Molecular Formula | C14H4Cl2N2O6 |
| Molecular Weight | 367.10 |
| CAS Registry Number | 6305-90-4 |
| EINECS | 228-616-7 |
| SMILES | C3=C([N+]([O-])=O)C2=C(C(=O)C1=C(Cl)C=CC(=C1C2=O)[N+]([O-])=O)C(=C3)Cl |
| InChI | 1S/C14H4Cl2N2O6/c15-5-1-3-7(17(21)22)11-9(5)13(19)10-6(16)2-4-8(18(23)24)12(10)14(11)20/h1-4H |
| InChIKey | OELAYHGIGDSWPY-UHFFFAOYSA-N |
| Density | 1.776g/cm3 (Cal.) |
|---|---|
| Boiling point | 612.398°C at 760 mmHg (Cal.) |
| Flash point | 324.167°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,8-Dichloro-4,5-Dinitroanthraquinone |