|
CAS#: 6307-51-3 Product: (4-Methoxyphenyl)Arsonic Acid No suppilers available for the product. |
| Name | (4-Methoxyphenyl)Arsonic Acid |
|---|---|
| Synonyms | P-Methoxybenzenearsonic Acid; Arsonic Acid, (4-Methoxyphenyl)- (9Ci); Nsc 41366 |
| Molecular Structure | ![]() |
| Molecular Formula | C7H9AsO4 |
| Molecular Weight | 232.07 |
| CAS Registry Number | 6307-51-3 |
| SMILES | C1=CC(=CC=C1OC)[As](=O)(O)O |
| InChI | 1S/C7H9AsO4/c1-12-7-4-2-6(3-5-7)8(9,10)11/h2-5H,1H3,(H2,9,10,11) |
| InChIKey | JNDUBNWTNMWLAR-UHFFFAOYSA-N |
| Boiling point | 461.25°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 192.533°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4-Methoxyphenyl)Arsonic Acid |