|
CAS#: 6309-41-7 Product: 1-Ethyl-3,3-Diphenyl-Pyrrolidin-2-One No suppilers available for the product. |
| Name | 1-Ethyl-3,3-Diphenyl-Pyrrolidin-2-One |
|---|---|
| Synonyms | 1-Ethyl-3,3-Di(Phenyl)-2-Pyrrolidinone; 1-Ethyl-3,3-Di(Phenyl)-2-Pyrrolidone; Nsc42557 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.35 |
| CAS Registry Number | 6309-41-7 |
| SMILES | C3=CC=C(C1(C(N(CC1)CC)=O)C2=CC=CC=C2)C=C3 |
| InChI | 1S/C18H19NO/c1-2-19-14-13-18(17(19)20,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12H,2,13-14H2,1H3 |
| InChIKey | ODLXOOGRJVNXIL-UHFFFAOYSA-N |
| Density | 1.103g/cm3 (Cal.) |
|---|---|
| Boiling point | 424.372°C at 760 mmHg (Cal.) |
| Flash point | 172.736°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Ethyl-3,3-Diphenyl-Pyrrolidin-2-One |