|
CAS#: 6310-15-2 Product: 1-Chloro-3-[3-(Trifluoromethyl)Phenyl]Propan-2-Ol No suppilers available for the product. |
| Name | 1-Chloro-3-[3-(Trifluoromethyl)Phenyl]Propan-2-Ol |
|---|---|
| Synonyms | Nsc43031 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10ClF3O |
| Molecular Weight | 238.64 |
| CAS Registry Number | 6310-15-2 |
| SMILES | C1=CC(=CC(=C1)CC(CCl)O)C(F)(F)F |
| InChI | 1S/C10H10ClF3O/c11-6-9(15)5-7-2-1-3-8(4-7)10(12,13)14/h1-4,9,15H,5-6H2 |
| InChIKey | ZFXGKQTVBSBJSU-UHFFFAOYSA-N |
| Density | 1.315g/cm3 (Cal.) |
|---|---|
| Boiling point | 272.862°C at 760 mmHg (Cal.) |
| Flash point | 118.823°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Chloro-3-[3-(Trifluoromethyl)Phenyl]Propan-2-Ol |