|
CAS#: 6310-97-0 Product: Butyl N-[(4-Nitrophenyl)Methylideneamino]Carbamate No suppilers available for the product. |
| Name | Butyl N-[(4-Nitrophenyl)Methylideneamino]Carbamate |
|---|---|
| Synonyms | Butyl N-[(4-Nitrophenyl)Methyleneamino]Carbamate; N-[(4-Nitrophenyl)Methyleneamino]Carbamic Acid Butyl Ester; N-[(4-Nitrobenzylidene)Amino]Carbamic Acid Butyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.27 |
| CAS Registry Number | 6310-97-0 |
| SMILES | C1=C(C=CC(=C1)[N+]([O-])=O)\C=N\NC(OCCCC)=O |
| InChI | 1S/C12H15N3O4/c1-2-3-8-19-12(16)14-13-9-10-4-6-11(7-5-10)15(17)18/h4-7,9H,2-3,8H2,1H3,(H,14,16)/b13-9+ |
| InChIKey | WMWCPDFOHKGNJC-UKTHLTGXSA-N |
| Density | 1.234g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Butyl N-[(4-Nitrophenyl)Methylideneamino]Carbamate |