|
CAS#: 63123-25-1 Product: 1-Ethyl-4,5-Dihydronaphtho[1,2-d]Thiazole-2(1H)-Thione No suppilers available for the product. |
| Name | 1-Ethyl-4,5-Dihydronaphtho[1,2-d]Thiazole-2(1H)-Thione |
|---|---|
| Synonyms | Naphtho(1,2-D)Thiazole-2(1H)-Thione, 1-Ethyl-4,5-Dihydro- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H13NS2 |
| Molecular Weight | 247.37 |
| CAS Registry Number | 63123-25-1 |
| SMILES | C1=CC=CC3=C1C2=C(SC(=S)N2CC)CC3 |
| InChI | 1S/C13H13NS2/c1-2-14-12-10-6-4-3-5-9(10)7-8-11(12)16-13(14)15/h3-6H,2,7-8H2,1H3 |
| InChIKey | LLLDOZVMMUSWMD-UHFFFAOYSA-N |
| Density | 1.331g/cm3 (Cal.) |
|---|---|
| Boiling point | 396.861°C at 760 mmHg (Cal.) |
| Flash point | 193.815°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Ethyl-4,5-Dihydronaphtho[1,2-d]Thiazole-2(1H)-Thione |