|
CAS#: 63129-86-2 Product: S-(4-Aminophenyl)-L-cysteine No suppilers available for the product. |
| Name | S-(4-Aminophenyl)-L-cysteine |
|---|---|
| Synonyms | (2R)-2-Amino-3-(4-Aminophenyl)Sulfanyl-Propanoic Acid; (2R)-2-Amino-3-[(4-Aminophenyl)Thio]Propanoic Acid; (2R)-2-Amino-3-[(4-Aminophenyl)Thio]Propionic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C9H12N2O2S |
| Molecular Weight | 212.27 |
| CAS Registry Number | 63129-86-2 |
| SMILES | [C@H](N)(CSC1=CC=C(N)C=C1)C(=O)O |
| InChI | 1S/C9H12N2O2S/c10-6-1-3-7(4-2-6)14-5-8(11)9(12)13/h1-4,8H,5,10-11H2,(H,12,13)/t8-/m0/s1 |
| InChIKey | MKNUDZLYGPHPRY-QMMMGPOBSA-N |
| Density | 1.362g/cm3 (Cal.) |
|---|---|
| Boiling point | 443.723°C at 760 mmHg (Cal.) |
| Flash point | 222.156°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for S-(4-Aminophenyl)-L-cysteine |