|
CAS#: 63133-79-9 Product: (2,4,6-Trichlorophenyl)Hydrazine Sulphate No suppilers available for the product. |
| Name | (2,4,6-Trichlorophenyl)Hydrazine Sulphate |
|---|---|
| Synonyms | Hydrazine, (2,4,6-Trichlorophenyl)-, Sulfate; (2,4,6-Trichlorophenyl)Hydrazine Sulphate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H7Cl3N2O4S |
| Molecular Weight | 309.55 |
| CAS Registry Number | 63133-79-9 |
| EINECS | 263-894-3 |
| SMILES | C1=C(Cl)C=C(Cl)C(=C1Cl)NN.O=[S](=O)(O)O |
| InChI | 1S/C6H5Cl3N2.H2O4S/c7-3-1-4(8)6(11-10)5(9)2-3;1-5(2,3)4/h1-2,11H,10H2;(H2,1,2,3,4) |
| InChIKey | LXJKAYIKPLXFKH-UHFFFAOYSA-N |
| Boiling point | 273.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 119.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2,4,6-Trichlorophenyl)Hydrazine Sulphate |