|
CAS#: 63136-62-9 Product: 4-Chloro-2,3-Dimethylquinoline No suppilers available for the product. |
| Name | 4-Chloro-2,3-Dimethylquinoline |
|---|---|
| Synonyms | 4-Chloro-2,3-Dimethyl-Quinoline; Nsc39975; Quinoline, 4-Chloro-2,3-Dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H10ClN |
| Molecular Weight | 191.66 |
| CAS Registry Number | 63136-62-9 |
| SMILES | C1=C2C(=CC=C1)N=C(C(=C2Cl)C)C |
| InChI | 1S/C11H10ClN/c1-7-8(2)13-10-6-4-3-5-9(10)11(7)12/h3-6H,1-2H3 |
| InChIKey | KQXLLCFFOGCXJH-UHFFFAOYSA-N |
| Density | 1.188g/cm3 (Cal.) |
|---|---|
| Boiling point | 290.759°C at 760 mmHg (Cal.) |
| Flash point | 157.307°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-2,3-Dimethylquinoline |