|
CAS#: 63148-10-7 Product: Benzo(a)pyrene-3,6-diol No suppilers available for the product. |
| Name | Benzo(a)pyrene-3,6-diol |
|---|---|
| Synonyms | 3,6-Dihydroxybenzo(A)Pyrene; Bp-3,6-Quinol; Benzo(A)Pyrene-3,6-Diol |
| Molecular Structure | ![]() |
| Molecular Formula | C20H12O2 |
| Molecular Weight | 284.31 |
| CAS Registry Number | 63148-10-7 |
| SMILES | C1=CC5=C4C2=C(C3=C(C(=C12)O)C=CC=C3)C=CC4=CC=C5O |
| InChI | 1S/C20H12O2/c21-17-10-6-11-5-7-13-12-3-1-2-4-14(12)20(22)16-9-8-15(17)18(11)19(13)16/h1-10,21-22H |
| InChIKey | MNYTULBCYDHGOF-UHFFFAOYSA-N |
| Density | 1.473g/cm3 (Cal.) |
|---|---|
| Boiling point | 589.098°C at 760 mmHg (Cal.) |
| Flash point | 287.743°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzo(a)pyrene-3,6-diol |