|
CAS#: 63149-81-5 Product: 2-(2,8-Dinitrooctyl)phenol No suppilers available for the product. |
| Name | 2-(2,8-Dinitrooctyl)phenol |
|---|---|
| Synonyms | Dinitrooctylphenol |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 |
| CAS Registry Number | 63149-81-5 |
| EINECS | 263-969-0 |
| SMILES | C1=CC=CC(=C1CC([N+]([O-])=O)CCCCCC[N+]([O-])=O)O |
| InChI | 1S/C14H20N2O5/c17-14-9-5-4-7-12(14)11-13(16(20)21)8-3-1-2-6-10-15(18)19/h4-5,7,9,13,17H,1-3,6,8,10-11H2 |
| InChIKey | IEAIACCKVIARIW-UHFFFAOYSA-N |
| Density | 1.206g/cm3 (Cal.) |
|---|---|
| Boiling point | 474.183°C at 760 mmHg (Cal.) |
| Flash point | 193.896°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2,8-Dinitrooctyl)phenol |