|
CAS#: 6318-09-8 Product: 1,3-Diamino-2,4,6-Triisopropylbenzene No suppilers available for the product. |
| Name | 1,3-Diamino-2,4,6-Triisopropylbenzene |
|---|---|
| Synonyms | 2,4,6-Triisopropylbenzene-1,3-Diamine; (3-Amino-2,4,6-Triisopropyl-Phenyl)Amine; Nsc28619 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.38 |
| CAS Registry Number | 6318-09-8 |
| SMILES | C1=C(C(=C(C(=C1C(C)C)N)C(C)C)N)C(C)C |
| InChI | 1S/C15H26N2/c1-8(2)11-7-12(9(3)4)15(17)13(10(5)6)14(11)16/h7-10H,16-17H2,1-6H3 |
| InChIKey | UCUPHRPMBXOFAU-UHFFFAOYSA-N |
| Density | 0.96g/cm3 (Cal.) |
|---|---|
| Boiling point | 348.68°C at 760 mmHg (Cal.) |
| Flash point | 196.048°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Diamino-2,4,6-Triisopropylbenzene |