Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | Sulfasomizole |
|---|---|
| Synonyms | 4-Amino-N-(3-Methylisothiazol-5-Yl)Benzenesulfonamide; 4-Amino-N-(3-Methyl-5-Isothiazolyl)Benzenesulfonamide; 2132 Th |
| Molecular Structure |  |
| Molecular Formula | C10H11N3O2S2 |
| Molecular Weight | 269.34 |
| CAS Registry Number | 632-00-8 |
| EINECS | 211-167-6 |
| SMILES | C1=CC(=CC=C1[S](NC2=CC(=NS2)C)(=O)=O)N |
| InChI | 1S/C10H11N3O2S2/c1-7-6-10(16-12-7)13-17(14,15)9-4-2-8(11)3-5-9/h2-6,13H,11H2,1H3 |
| InChIKey | JVYKJZPZFIUYAB-UHFFFAOYSA-N |
| Density | 1.498g/cm3 (Cal.) |
|---|---|
| Boiling point | 396.177°C at 760 mmHg (Cal.) |
| Flash point | 193.401°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sulfasomizole |