|
CAS#: 632-77-9 Product: 1,2,5,6-Tetrahydroxyanthraquinone No suppilers available for the product. |
| Name | 1,2,5,6-Tetrahydroxyanthraquinone |
|---|---|
| Synonyms | 1,2,5,6-Tetrahydroxy-9,10-Anthraquinone; Nsc133370; Chebi:37497 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H8O6 |
| Molecular Weight | 272.21 |
| CAS Registry Number | 632-77-9 |
| EINECS | 211-184-9 |
| SMILES | C3=CC1=C(C(C2=C(C1=O)C(=C(O)C=C2)O)=O)C(=C3O)O |
| InChI | 1S/C14H8O6/c15-7-3-1-5-9(13(7)19)12(18)6-2-4-8(16)14(20)10(6)11(5)17/h1-4,15-16,19-20H |
| InChIKey | UIAOMKQPMHYQTQ-UHFFFAOYSA-N |
| Density | 1.782g/cm3 (Cal.) |
|---|---|
| Boiling point | 481.464°C at 760 mmHg (Cal.) |
| Flash point | 259.088°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,5,6-Tetrahydroxyanthraquinone |