|
CAS#: 63216-83-1 Product: 5-[(4-Amino-5-Methoxy-o-Tolyl)Azo]-2-Methoxybenzenesulphonic Acid No suppilers available for the product. |
| Name | 5-[(4-Amino-5-Methoxy-o-Tolyl)Azo]-2-Methoxybenzenesulphonic Acid |
|---|---|
| Synonyms | 5-(4-Amino-5-Methoxy-2-Methyl-Phenyl)Azo-2-Methoxy-Benzenesulfonic Acid; 5-(4-Amino-5-Methoxy-2-Methylphenyl)Azo-2-Methoxybenzenesulfonic Acid; 5-(4-Amino-5-Methoxy-2-Methyl-Phenyl)Diazenyl-2-Methoxy-Benzenesulfonic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C15H17N3O5S |
| Molecular Weight | 351.38 |
| CAS Registry Number | 63216-83-1 |
| EINECS | 264-002-5 |
| SMILES | C1=C(C=CC(=C1[S](=O)(=O)O)OC)N=NC2=C(C=C(C(=C2)OC)N)C |
| InChI | 1S/C15H17N3O5S/c1-9-6-11(16)14(23-3)8-12(9)18-17-10-4-5-13(22-2)15(7-10)24(19,20)21/h4-8H,16H2,1-3H3,(H,19,20,21) |
| InChIKey | IEZSGDNUYFXTGX-UHFFFAOYSA-N |
| Density | 1.399g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 5-[(4-Amino-5-Methoxy-o-Tolyl)Azo]-2-Methoxybenzenesulphonic Acid |