|
CAS#: 63217-38-9 Product: 6,7-Bis[(Phenylsulphonyl)Oxy]Naphthalene-2-Sulphonamide No suppilers available for the product. |
| Name | 6,7-Bis[(Phenylsulphonyl)Oxy]Naphthalene-2-Sulphonamide |
|---|---|
| Synonyms | (3-Phenylsulfonyloxy-7-Sulfamoyl-2-Naphthyl) Benzenesulfonate; Benzenesulfonic Acid (3-Phenylsulfonyloxy-7-Sulfamoyl-2-Naphthyl) Ester; (3-Phenylsulfonyloxy-7-Sulfamoyl-Naphthalen-2-Yl) Benzenesulfonate |
| Molecular Structure | ![]() |
| Molecular Formula | C22H17NO8S3 |
| Molecular Weight | 519.56 |
| CAS Registry Number | 63217-38-9 |
| EINECS | 264-029-2 |
| SMILES | C3=C2C=C(O[S](=O)(=O)C1=CC=CC=C1)C(=CC2=CC=C3[S](=O)(=O)N)O[S](=O)(=O)C4=CC=CC=C4 |
| InChI | 1S/C22H17NO8S3/c23-32(24,25)20-12-11-16-14-21(30-33(26,27)18-7-3-1-4-8-18)22(15-17(16)13-20)31-34(28,29)19-9-5-2-6-10-19/h1-15H,(H2,23,24,25) |
| InChIKey | KVZQMLGVEQKEHF-UHFFFAOYSA-N |
| Density | 1.529g/cm3 (Cal.) |
|---|---|
| Boiling point | 782.832°C at 760 mmHg (Cal.) |
| Flash point | 427.241°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,7-Bis[(Phenylsulphonyl)Oxy]Naphthalene-2-Sulphonamide |